CAS 50528-80-8 is the registry number for 2,4,6–Trifluorophenyl Isocyanate. Offered by: GLPBio. Available pack sizes: 1g.
1,3,5-trifluoro-2-isocyanatobenzene (CAS 50528-80-8) is a chemical compound with the molecular formula C7H2F3NO and a molecular weight of 173.09 g/mol. IUPAC name: 1,3,5-trifluoro-2-isocyanatobenzene. InChIKey: XORSGSHLSDFOHP-UHFFFAOYSA-N.
| Molecular formula | C7H2F3NO |
|---|---|
| Molecular weight | 173.09 g/mol |
| IUPAC name | 1,3,5-trifluoro-2-isocyanatobenzene |
| InChIKey | XORSGSHLSDFOHP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)N=C=O)F)F |
Computed by PubChem (NCBI)