Products 19078-72-9
CAS 19078-72-9 appears in our catalog under these names: 2-Bromo-2-phenylacetyl chloride, 95%, α-Bromophenylacetyl chloride, 97%, 2-Bromo-2-phenylacetyl chloride, 97%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-2-phenylacetyl chloride (CAS 19078-72-9) is a chemical compound with the molecular formula C8H6BrClO and a molecular weight of 233.49 g/mol. IUPAC name: 2-bromo-2-phenylacetyl chloride. InChIKey: UDEJUBDPPQVWEX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO |
|---|---|
| Molecular weight | 233.49 g/mol |
| IUPAC name | 2-bromo-2-phenylacetyl chloride |
| InChIKey | UDEJUBDPPQVWEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)Cl)Br |
Computed by PubChem (NCBI)
Synonyms:
Bromophenylacetyl chloride, 2-bromo-2-phenylacetyl chloride, alpha-Bromophenylacetyl chloride, alpha-bromophenylacetylchloride, bromo(phenyl)acetyl chloride, Acetyl chloride, bromophenyl-, bromophenylacetic acid chloride, Benzeneacetyl chloride, .alpha.-bromo-, a-bromophenylacetyl chloride, Bromo-phenyl-acetyl chloride