Products 190780-66-6
CAS 190780-66-6 is the registry number for p-Cresol-d8, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,2,4,5-tetradeuterio-3-deuteriooxy-6-(trideuteriomethyl)benzene (CAS 190780-66-6) is a chemical compound with the molecular formula C7H8O and a molecular weight of 116.19 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3-deuteriooxy-6-(trideuteriomethyl)benzene. InChIKey: IWDCLRJOBJJRNH-IWRLGKISSA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 116.19 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3-deuteriooxy-6-(trideuteriomethyl)benzene |
| InChIKey | IWDCLRJOBJJRNH-IWRLGKISSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)