Products 202325-52-8
CAS 202325-52-8 appears in our catalog under these names: p-Cresol-d7, >95% (HPLC), p-Cresol-d7, 98 atom % D, min 98% Chemical Purity, p–Cresol–d7. Offered by: TRC, CDN, GLPBio. Available pack sizes: 100mg, 10mg, 25mg, 1g, 0,5g, 5mg.
2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenol (CAS 202325-52-8) is a chemical compound with the molecular formula C7H8O and a molecular weight of 115.18 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenol. InChIKey: IWDCLRJOBJJRNH-AAYPNNLASA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 115.18 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenol |
| InChIKey | IWDCLRJOBJJRNH-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)