CAS 3646-98-8 is the registry number for p-Cresol-2,3,5,6-d4,OD, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,2,4,5-tetradeuterio-3-deuteriooxy-6-methylbenzene (CAS 3646-98-8) is a chemical compound with the molecular formula C7H8O and a molecular weight of 113.17 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3-deuteriooxy-6-methylbenzene. InChIKey: IWDCLRJOBJJRNH-MDXQMYCFSA-N.
| Molecular formula | C7H8O |
|---|---|
| Molecular weight | 113.17 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3-deuteriooxy-6-methylbenzene |
| InChIKey | IWDCLRJOBJJRNH-MDXQMYCFSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C)[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)