Products 1908436-03-2

CAS 1908436-03-2 is the registry number for [2-(3'-Formyl-biphenyl-3-yloxy)-ethyl]-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-[3-(3-formylphenyl)phenoxy]ethyl]carbamate (CAS 1908436-03-2) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: tert-butyl N-[2-[3-(3-formylphenyl)phenoxy]ethyl]carbamate. InChIKey: WZYMRFYKRNMWDU-UHFFFAOYSA-N.

Identity
Molecular formulaC20H23NO4
Molecular weight341.4 g/mol
IUPAC nametert-butyl N-[2-[3-(3-formylphenyl)phenoxy]ethyl]carbamate
InChIKeyWZYMRFYKRNMWDU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCOC1=CC=CC(=C1)C2=CC=CC(=C2)C=O

Computed by PubChem (NCBI)