CAS 959577-47-0 is the registry number for Boc-(+/-)-trans-4-(1-naphthyl)-pyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-naphthalen-1-ylpyrrolidine-3-carboxylic acid (CAS 959577-47-0) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: (3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-naphthalen-1-ylpyrrolidine-3-carboxylic acid. InChIKey: XFLHWJLBGXTNJN-SJORKVTESA-N.
| Molecular formula | C20H23NO4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-naphthalen-1-ylpyrrolidine-3-carboxylic acid |
| InChIKey | XFLHWJLBGXTNJN-SJORKVTESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)O)C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)