CAS 119363-63-2 appears in our catalog under these names: 2–((tert–Butoxycarbonyl)amino)–3,3–diphenylpropanoic acid, 2-Boc-amino-3,3-diphenyl propionic acid, 95%, 2-((tert-Butoxycarbonyl)amino)-3,3-diphenylpropanoic acid, 97%, 2-BOC-AMINO-3,3-DIPHENYL PROPIONIC ACID, 98%. Offered by: GLPBio, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid (CAS 119363-63-2) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid. InChIKey: TYJDOLCFYZSNQC-UHFFFAOYSA-N.
| Molecular formula | C20H23NO4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid |
| InChIKey | TYJDOLCFYZSNQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(C1=CC=CC=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)