Products 190853-52-2
CAS 190853-52-2 is the registry number for 3-(2,3-Dihydro-1h-inden-5-yloxy)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(2,3-dihydro-1H-inden-5-yloxy)propanoic acid (CAS 190853-52-2) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 3-(2,3-dihydro-1H-inden-5-yloxy)propanoic acid. InChIKey: GKFJCUQVJAVBCW-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 3-(2,3-dihydro-1H-inden-5-yloxy)propanoic acid |
| InChIKey | GKFJCUQVJAVBCW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)OCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-indan-5-yloxypropanoic acid