CAS 1909293-69-1 appears in our catalog under these names: (1S,2R)-2-(Aminomethyl)cyclohexan-1-ol hydrochloride, 95%, (1S,2R)-2-(Aminomethyl)cyclohexan-1-ol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Cis-(1S,2R)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride (CAS 1909293-69-1) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: cis-(1S,2R)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride. InChIKey: UVYXWKUCIQHOCP-HHQFNNIRSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | cis-(1S,2R)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride |
| InChIKey | UVYXWKUCIQHOCP-HHQFNNIRSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)CN)O.Cl |
Computed by PubChem (NCBI)