CAS 24948-05-8 is the registry number for rel-(1R,2S)-2-(Aminomethyl)cyclohexan-1-ol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,2S)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride (CAS 24948-05-8) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: cis-(1R,2S)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride. InChIKey: UVYXWKUCIQHOCP-UOERWJHTSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | cis-(1R,2S)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride |
| InChIKey | UVYXWKUCIQHOCP-UOERWJHTSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)CN)O.Cl |
Computed by PubChem (NCBI)