CAS 24947-68-0 appears in our catalog under these names: cis-2-(Aminomethyl)cyclohexanol hydrochloride, 95+%, cis-2-Aminomethyl-1-cyclohexanol hydrochloride, 99%. Offered by: AmBeed, Thermo Scientific (Acros). Available pack sizes: 1g, 250MG.
Trans-(1S,2S)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride (CAS 24947-68-0) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: trans-(1S,2S)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride. InChIKey: UVYXWKUCIQHOCP-LEUCUCNGSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | trans-(1S,2S)-2-(aminomethyl)cyclohexan-1-ol;hydrochloride |
| InChIKey | UVYXWKUCIQHOCP-LEUCUCNGSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)CN)O.Cl |
Computed by PubChem (NCBI)