CAS 1909295-03-9 appears in our catalog under these names: (6S)-4,5,6,7-Tetrahydro-1,3-benzothiazol-6-amine dihydrochloride, 95%, (6S)-4,5,6,7-Tetrahydro-1,3-benzothiazol-6-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(6S)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-amine;dihydrochloride (CAS 1909295-03-9) is a chemical compound with the molecular formula C7H12Cl2N2S and a molecular weight of 227.15 g/mol. IUPAC name: (6S)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-amine;dihydrochloride. InChIKey: PHKYCWWMEZVIIT-XRIGFGBMSA-N.
| Molecular formula | C7H12Cl2N2S |
|---|---|
| Molecular weight | 227.15 g/mol |
| IUPAC name | (6S)-4,5,6,7-tetrahydro-1,3-benzothiazol-6-amine;dihydrochloride |
| InChIKey | PHKYCWWMEZVIIT-XRIGFGBMSA-N |
| SMILES | C1CC2=C(C[C@H]1N)SC=N2.Cl.Cl |
Computed by PubChem (NCBI)