CAS 2172600-26-7 is the registry number for 1-(2-Methyl-1,3-thiazol-4-yl)cyclopropan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2-methyl-1,3-thiazol-4-yl)cyclopropan-1-amine;dihydrochloride (CAS 2172600-26-7) is a chemical compound with the molecular formula C7H12Cl2N2S and a molecular weight of 227.15 g/mol. IUPAC name: 1-(2-methyl-1,3-thiazol-4-yl)cyclopropan-1-amine;dihydrochloride. InChIKey: PNRHLGRLUUDBTH-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2S |
|---|---|
| Molecular weight | 227.15 g/mol |
| IUPAC name | 1-(2-methyl-1,3-thiazol-4-yl)cyclopropan-1-amine;dihydrochloride |
| InChIKey | PNRHLGRLUUDBTH-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2(CC2)N.Cl.Cl |
Computed by PubChem (NCBI)