CAS 2503204-25-7 is the registry number for (5,6-Dihydro-4H-cyclopenta(d)thiazol-2-yl)methanamine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethanamine;dihydrochloride (CAS 2503204-25-7) is a chemical compound with the molecular formula C7H12Cl2N2S and a molecular weight of 227.15 g/mol. IUPAC name: 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethanamine;dihydrochloride. InChIKey: ABSJKPOPSYFMNH-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2S |
|---|---|
| Molecular weight | 227.15 g/mol |
| IUPAC name | 5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethanamine;dihydrochloride |
| InChIKey | ABSJKPOPSYFMNH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)