Products 1909296-30-5
CAS 1909296-30-5 is the registry number for 2-Bromo-2,2-difluoro-1-(1H-indol-3-yl)ethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2-bromo-2,2-difluoro-1-(1H-indol-3-yl)ethanone (CAS 1909296-30-5) is a chemical compound with the molecular formula C10H6BrF2NO and a molecular weight of 274.06 g/mol. IUPAC name: 2-bromo-2,2-difluoro-1-(1H-indol-3-yl)ethanone. InChIKey: VWPDTMHMGJFVSG-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF2NO |
|---|---|
| Molecular weight | 274.06 g/mol |
| IUPAC name | 2-bromo-2,2-difluoro-1-(1H-indol-3-yl)ethanone |
| InChIKey | VWPDTMHMGJFVSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)C(F)(F)Br |
Computed by PubChem (NCBI)