Products 199872-10-1
CAS 199872-10-1 appears in our catalog under these names: 5-Bromo-8-(difluoromethoxy)quinoline, 95%, 5–Bromo–8–(difluoromethoxy)quinoline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
5-bromo-8-(difluoromethoxy)quinoline (CAS 199872-10-1) is a chemical compound with the molecular formula C10H6BrF2NO and a molecular weight of 274.06 g/mol. IUPAC name: 5-bromo-8-(difluoromethoxy)quinoline. InChIKey: XOINTQKILDHQHQ-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF2NO |
|---|---|
| Molecular weight | 274.06 g/mol |
| IUPAC name | 5-bromo-8-(difluoromethoxy)quinoline |
| InChIKey | XOINTQKILDHQHQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)OC(F)F)Br |
Computed by PubChem (NCBI)