CAS 1527673-41-1 is the registry number for 3-(Bromomethyl)-5-(3,5-difluorophenyl)isoxazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(bromomethyl)-5-(3,5-difluorophenyl)-1,2-oxazole (CAS 1527673-41-1) is a chemical compound with the molecular formula C10H6BrF2NO and a molecular weight of 274.06 g/mol. IUPAC name: 3-(bromomethyl)-5-(3,5-difluorophenyl)-1,2-oxazole. InChIKey: ZQWQTYZJJWZVEI-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF2NO |
|---|---|
| Molecular weight | 274.06 g/mol |
| IUPAC name | 3-(bromomethyl)-5-(3,5-difluorophenyl)-1,2-oxazole |
| InChIKey | ZQWQTYZJJWZVEI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C2=CC(=NO2)CBr |
Computed by PubChem (NCBI)