CAS 2755695-51-1 is the registry number for 4-Bromo-6,7-difluoro-2-methylisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-6,7-difluoro-2-methylisoquinolin-1-one (CAS 2755695-51-1) is a chemical compound with the molecular formula C10H6BrF2NO and a molecular weight of 274.06 g/mol. IUPAC name: 4-bromo-6,7-difluoro-2-methylisoquinolin-1-one. InChIKey: UGHYEBSWRQBWRL-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF2NO |
|---|---|
| Molecular weight | 274.06 g/mol |
| IUPAC name | 4-bromo-6,7-difluoro-2-methylisoquinolin-1-one |
| InChIKey | UGHYEBSWRQBWRL-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC(=C(C=C2C1=O)F)F)Br |
Computed by PubChem (NCBI)