Products 1909296-42-9
CAS 1909296-42-9 is the registry number for 2,2-Difluoro-1-(5-methoxy-1-methyl-1H-indol-3-yl)ethan-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
2,2-difluoro-1-(5-methoxy-1-methylindol-3-yl)ethanone (CAS 1909296-42-9) is a chemical compound with the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. IUPAC name: 2,2-difluoro-1-(5-methoxy-1-methylindol-3-yl)ethanone. InChIKey: WXWLGMGMCZRGGH-UHFFFAOYSA-N.
| Molecular formula | C12H11F2NO2 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | 2,2-difluoro-1-(5-methoxy-1-methylindol-3-yl)ethanone |
| InChIKey | WXWLGMGMCZRGGH-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=CC(=C2)OC)C(=O)C(F)F |
Computed by PubChem (NCBI)