CAS 886362-67-0 appears in our catalog under these names: 4,5-Difluoro-2-methylindole-3-carboxylic acid ethyl ester, 95%, Ethyl 4,5-difluoro-2-methyl-1H-indole-3-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Ethyl 4,5-difluoro-2-methyl-1H-indole-3-carboxylate (CAS 886362-67-0) is a chemical compound with the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. IUPAC name: ethyl 4,5-difluoro-2-methyl-1H-indole-3-carboxylate. InChIKey: JWJWOIIIIAAFQN-UHFFFAOYSA-N.
| Molecular formula | C12H11F2NO2 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | ethyl 4,5-difluoro-2-methyl-1H-indole-3-carboxylate |
| InChIKey | JWJWOIIIIAAFQN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC2=C1C(=C(C=C2)F)F)C |
Computed by PubChem (NCBI)