CAS 932780-66-0 appears in our catalog under these names: 4-[(2,4-Difluorophenoxy)methyl]-3,5-dimethylisoxazole, 95%, 4-((2,4-Difluorophenoxy)methyl)-3,5-dimethylisoxazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-[(2,4-difluorophenoxy)methyl]-3,5-dimethyl-1,2-oxazole (CAS 932780-66-0) is a chemical compound with the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. IUPAC name: 4-[(2,4-difluorophenoxy)methyl]-3,5-dimethyl-1,2-oxazole. InChIKey: OWEALCQJNUMXOS-UHFFFAOYSA-N.
| Molecular formula | C12H11F2NO2 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | 4-[(2,4-difluorophenoxy)methyl]-3,5-dimethyl-1,2-oxazole |
| InChIKey | OWEALCQJNUMXOS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)COC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)