Products 1909305-07-2
CAS 1909305-07-2 is the registry number for 5-{1H,4H,5H,6H,7H-Imidazo(4,5-c)pyridin-4-yl}-1-methyl-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2-methylpyrazol-3-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine (CAS 1909305-07-2) is a chemical compound with the molecular formula C10H13N5 and a molecular weight of 203.24 g/mol. IUPAC name: 4-(2-methylpyrazol-3-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine. InChIKey: USZVVDPFFNBOEZ-UHFFFAOYSA-N.
| Molecular formula | C10H13N5 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4-(2-methylpyrazol-3-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine |
| InChIKey | USZVVDPFFNBOEZ-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2C3=C(CCN2)NC=N3 |
Computed by PubChem (NCBI)