Products 1909306-07-5
CAS 1909306-07-5 is the registry number for 2-Phenyl-5,7-diazaspiro(3.4)octane-6,8-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione (CAS 1909306-07-5) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione. InChIKey: WQBXONCCVVRFNY-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 2-phenyl-5,7-diazaspiro[3.4]octane-6,8-dione |
| InChIKey | WQBXONCCVVRFNY-UHFFFAOYSA-N |
| SMILES | C1C(CC12C(=O)NC(=O)N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)