CAS 1909313-65-0 appears in our catalog under these names: (4-(Oxazol-5-yl)phenyl)methanamine hydrochloride, 98%, (4-(1,3-Oxazol-5-yl)phenyl)methanamine hydrochloride, (4-(Oxazol-5-yl)phenyl)methanamine hydrochloride, 97%, 97%, (4-(Oxazol-5-yl)phenyl)methanamine hydrochloride, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 2,5g, 250mg, 100mg, 1g, 500mg.
[4-(1,3-oxazol-5-yl)phenyl]methanamine;hydrochloride (CAS 1909313-65-0) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: [4-(1,3-oxazol-5-yl)phenyl]methanamine;hydrochloride. InChIKey: FNKYTFAHGOYUNU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | [4-(1,3-oxazol-5-yl)phenyl]methanamine;hydrochloride |
| InChIKey | FNKYTFAHGOYUNU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C2=CN=CO2.Cl |
Computed by PubChem (NCBI)