Products 1909314-12-0

CAS 1909314-12-0 appears in our catalog under these names: [1-(Aminomethyl)cyclopropyl]acetic acid hydrochloride, 95%, 2-(1-(Aminomethyl)cyclopropyl)acetic acid hydrochloride, 98%, 2-(1-(Aminomethyl)cyclopropyl)acetic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 25g, 1g, 250mg, 5g, 0,5g.

Structural formula: {0} (CAS {1})

2-[1-(aminomethyl)cyclopropyl]acetic acid;hydrochloride (CAS 1909314-12-0) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: 2-[1-(aminomethyl)cyclopropyl]acetic acid;hydrochloride. InChIKey: REAADBVGZORNFO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO2
Molecular weight165.62 g/mol
IUPAC name2-[1-(aminomethyl)cyclopropyl]acetic acid;hydrochloride
InChIKeyREAADBVGZORNFO-UHFFFAOYSA-N
SMILESC1CC1(CC(=O)O)CN.Cl

Computed by PubChem (NCBI)