Products 1909317-41-4

CAS 1909317-41-4 is the registry number for tert-Butyl 4-hydroxy-1-azaspiro(4.5)decane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-hydroxy-1-azaspiro[4.5]decane-1-carboxylate (CAS 1909317-41-4) is a chemical compound with the molecular formula C14H25NO3 and a molecular weight of 255.35 g/mol. IUPAC name: tert-butyl 4-hydroxy-1-azaspiro[4.5]decane-1-carboxylate. InChIKey: SDJMIABEMRMQJW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H25NO3
Molecular weight255.35 g/mol
IUPAC nametert-butyl 4-hydroxy-1-azaspiro[4.5]decane-1-carboxylate
InChIKeySDJMIABEMRMQJW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(C12CCCCC2)O

Computed by PubChem (NCBI)