CAS 1909318-98-4 appears in our catalog under these names: 2-(Pyrrolidin-3-yl)-1,8-naphthyridine dihydrochloride, 95%, 2-(Pyrrolidin-3-yl)-1,8-naphthyridine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-pyrrolidin-3-yl-1,8-naphthyridine;dihydrochloride (CAS 1909318-98-4) is a chemical compound with the molecular formula C12H15Cl2N3 and a molecular weight of 272.17 g/mol. IUPAC name: 2-pyrrolidin-3-yl-1,8-naphthyridine;dihydrochloride. InChIKey: YTSTYSMGWQUTCP-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N3 |
|---|---|
| Molecular weight | 272.17 g/mol |
| IUPAC name | 2-pyrrolidin-3-yl-1,8-naphthyridine;dihydrochloride |
| InChIKey | YTSTYSMGWQUTCP-UHFFFAOYSA-N |
| SMILES | C1CNCC1C2=NC3=C(C=CC=N3)C=C2.Cl.Cl |
Computed by PubChem (NCBI)