Products 1909326-32-4
CAS 1909326-32-4 is the registry number for 1-(Piperidin-3-yl)-1H-1,2,3-triazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-piperidin-3-yltriazole-4-carboxylic acid;hydrochloride (CAS 1909326-32-4) is a chemical compound with the molecular formula C8H13ClN4O2 and a molecular weight of 232.67 g/mol. IUPAC name: 1-piperidin-3-yltriazole-4-carboxylic acid;hydrochloride. InChIKey: AVYOAYJXXXRVQX-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN4O2 |
|---|---|
| Molecular weight | 232.67 g/mol |
| IUPAC name | 1-piperidin-3-yltriazole-4-carboxylic acid;hydrochloride |
| InChIKey | AVYOAYJXXXRVQX-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)N2C=C(N=N2)C(=O)O.Cl |
Computed by PubChem (NCBI)