Products 2361609-68-7
CAS 2361609-68-7 is the registry number for 6-((3S)-3-Aminopyrrolidin-1-yl)-1,2,3,4-tetrahydropyrimidine-2,4-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-[(3S)-3-aminopyrrolidin-1-yl]-1H-pyrimidine-2,4-dione;hydrochloride (CAS 2361609-68-7) is a chemical compound with the molecular formula C8H13ClN4O2 and a molecular weight of 232.67 g/mol. IUPAC name: 6-[(3S)-3-aminopyrrolidin-1-yl]-1H-pyrimidine-2,4-dione;hydrochloride. InChIKey: PLXCBNBSSTYASP-JEDNCBNOSA-N.
| Molecular formula | C8H13ClN4O2 |
|---|---|
| Molecular weight | 232.67 g/mol |
| IUPAC name | 6-[(3S)-3-aminopyrrolidin-1-yl]-1H-pyrimidine-2,4-dione;hydrochloride |
| InChIKey | PLXCBNBSSTYASP-JEDNCBNOSA-N |
| SMILES | C1CN(C[C@H]1N)C2=CC(=O)NC(=O)N2.Cl |
Computed by PubChem (NCBI)