Products 2918779-82-3

CAS 2918779-82-3 is the registry number for Ethyl 1-(azetidin-3-yl)-1H-1,2,3-triazole-4-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Ethyl 1-(azetidin-3-yl)triazole-4-carboxylate;hydrochloride (CAS 2918779-82-3) is a chemical compound with the molecular formula C8H13ClN4O2 and a molecular weight of 232.67 g/mol. IUPAC name: ethyl 1-(azetidin-3-yl)triazole-4-carboxylate;hydrochloride. InChIKey: VMFBVRZEYLOZJF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN4O2
Molecular weight232.67 g/mol
IUPAC nameethyl 1-(azetidin-3-yl)triazole-4-carboxylate;hydrochloride
InChIKeyVMFBVRZEYLOZJF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN(N=N1)C2CNC2.Cl

Computed by PubChem (NCBI)