CAS 1909336-26-0 is the registry number for 2-(Trifluoromethyl)-1,3-benzothiazole-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(trifluoromethyl)-1,3-benzothiazole-4-carbonitrile (CAS 1909336-26-0) is a chemical compound with the molecular formula C9H3F3N2S and a molecular weight of 228.20 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-benzothiazole-4-carbonitrile. InChIKey: IVSOVDHULNFGMF-UHFFFAOYSA-N.
| Molecular formula | C9H3F3N2S |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-benzothiazole-4-carbonitrile |
| InChIKey | IVSOVDHULNFGMF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)C(F)(F)F)C#N |
Computed by PubChem (NCBI)