Products 285125-02-2
CAS 285125-02-2 is the registry number for 4-Cyano-2-(trifluoromethyl)phenylisothiocyanate, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
4-isothiocyanato-3-(trifluoromethyl)benzonitrile (CAS 285125-02-2) is a chemical compound with the molecular formula C9H3F3N2S and a molecular weight of 228.20 g/mol. IUPAC name: 4-isothiocyanato-3-(trifluoromethyl)benzonitrile. InChIKey: JQJUBCSLYJYXFZ-UHFFFAOYSA-N.
| Molecular formula | C9H3F3N2S |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | 4-isothiocyanato-3-(trifluoromethyl)benzonitrile |
| InChIKey | JQJUBCSLYJYXFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(F)(F)F)N=C=S |
Computed by PubChem (NCBI)