Products 1909337-74-1
CAS 1909337-74-1 appears in our catalog under these names: 3-Ethylazetidine, trifluoroacetic acid, 3-Ethylazetidine 2,2,2-trifluoroacetate, 95%, 3-ethylazetidine,2,2,2-trifluoroacetic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g, 5g, 10g, 25g, 100mg, 500mg.
3-ethylazetidine;2,2,2-trifluoroacetic acid (CAS 1909337-74-1) is a chemical compound with the molecular formula C7H12F3NO2 and a molecular weight of 199.17 g/mol. IUPAC name: 3-ethylazetidine;2,2,2-trifluoroacetic acid. InChIKey: YOYDLYQWUBZMIW-UHFFFAOYSA-N.
| Molecular formula | C7H12F3NO2 |
|---|---|
| Molecular weight | 199.17 g/mol |
| IUPAC name | 3-ethylazetidine;2,2,2-trifluoroacetic acid |
| InChIKey | YOYDLYQWUBZMIW-UHFFFAOYSA-N |
| SMILES | CCC1CNC1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)