CAS 1909348-32-8 is the registry number for 4-Amino-1-methyl-1,2,3,4-tetrahydroquinoline-4-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-1-methyl-2,3-dihydroquinoline-4-carboxylic acid;dihydrochloride (CAS 1909348-32-8) is a chemical compound with the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.16 g/mol. IUPAC name: 4-amino-1-methyl-2,3-dihydroquinoline-4-carboxylic acid;dihydrochloride. InChIKey: STKHDGDTKDRUOE-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2O2 |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | 4-amino-1-methyl-2,3-dihydroquinoline-4-carboxylic acid;dihydrochloride |
| InChIKey | STKHDGDTKDRUOE-UHFFFAOYSA-N |
| SMILES | CN1CCC(C2=CC=CC=C21)(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)