CAS 1965308-82-0 is the registry number for 5,6,7,8-Tetrahydro-(1,6)naphthyridine-3-carboxylic acid ethyl ester dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate;dihydrochloride (CAS 1965308-82-0) is a chemical compound with the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.16 g/mol. IUPAC name: ethyl 5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate;dihydrochloride. InChIKey: CWSRBKHIEJHHGW-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2O2 |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | ethyl 5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate;dihydrochloride |
| InChIKey | CWSRBKHIEJHHGW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(CCNC2)N=C1.Cl.Cl |
Computed by PubChem (NCBI)