CAS 354813-11-9 is the registry number for 4-(Piperazin-1-yl)benzoic acid dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
4-piperazin-1-ylbenzoic acid;dihydrochloride (CAS 354813-11-9) is a chemical compound with the molecular formula C11H16Cl2N2O2 and a molecular weight of 279.16 g/mol. IUPAC name: 4-piperazin-1-ylbenzoic acid;dihydrochloride. InChIKey: JIEHDSDPUDKDLX-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N2O2 |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | 4-piperazin-1-ylbenzoic acid;dihydrochloride |
| InChIKey | JIEHDSDPUDKDLX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)