Products 1909358-88-8
CAS 1909358-88-8 is the registry number for 2-Methyl-3-(pyridin-3-yl)prop-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
(E)-2-methyl-3-pyridin-3-ylprop-2-enoic acid (CAS 1909358-88-8) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (E)-2-methyl-3-pyridin-3-ylprop-2-enoic acid. InChIKey: PFLDXMZZVKOXGU-FNORWQNLSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (E)-2-methyl-3-pyridin-3-ylprop-2-enoic acid |
| InChIKey | PFLDXMZZVKOXGU-FNORWQNLSA-N |
| SMILES | C/C(=C\C1=CN=CC=C1)/C(=O)O |
Computed by PubChem (NCBI)