Products 1909358-89-9
CAS 1909358-89-9 is the registry number for 2-Methyl-3-(pyridin-3-yl)prop-2-enoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(E)-2-methyl-3-pyridin-3-ylprop-2-enoic acid;hydrochloride (CAS 1909358-89-9) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: (E)-2-methyl-3-pyridin-3-ylprop-2-enoic acid;hydrochloride. InChIKey: YDNGUUQQCFHXSY-GZOLSCHFSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | (E)-2-methyl-3-pyridin-3-ylprop-2-enoic acid;hydrochloride |
| InChIKey | YDNGUUQQCFHXSY-GZOLSCHFSA-N |
| SMILES | C/C(=C\C1=CN=CC=C1)/C(=O)O.Cl |
Computed by PubChem (NCBI)