CAS 190957-31-4 is the registry number for Ethyl (1R, 3R)-5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxylate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
Ethyl (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate (CAS 190957-31-4) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: ethyl (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate. InChIKey: BIKRYOSLVLNBBR-DGCLKSJQSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | ethyl (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate |
| InChIKey | BIKRYOSLVLNBBR-DGCLKSJQSA-N |
| SMILES | CCOC(=O)[C@@H]1CC(=O)N(C1)[C@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)