CAS 190967-68-1 appears in our catalog under these names: (R)-Sulindac, (R)-Sulindac, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 5mg, 10mg, 25mg.
2-[(3Z)-6-fluoro-2-methyl-3-[[4-[(R)-methylsulfinyl]phenyl]methylidene]inden-1-yl]acetic acid (CAS 190967-68-1) is a chemical compound with the molecular formula C20H17FO3S and a molecular weight of 356.4 g/mol. IUPAC name: 2-[(3Z)-6-fluoro-2-methyl-3-[[4-[(R)-methylsulfinyl]phenyl]methylidene]inden-1-yl]acetic acid. InChIKey: MLKXDPUZXIRXEP-LQVWSKNFSA-N.
| Molecular formula | C20H17FO3S |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 2-[(3Z)-6-fluoro-2-methyl-3-[[4-[(R)-methylsulfinyl]phenyl]methylidene]inden-1-yl]acetic acid |
| InChIKey | MLKXDPUZXIRXEP-LQVWSKNFSA-N |
| SMILES | CC\1=C(C2=C(/C1=C\C3=CC=C(C=C3)[S@](=O)C)C=CC(=C2)F)CC(=O)O |
Computed by PubChem (NCBI)