Products 61849-35-2

CAS 61849-35-2 appears in our catalog under these names: Sulindac Impurity 1, Sulindac Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methyl]inden-1-ylidene]acetic acid (CAS 61849-35-2) is a chemical compound with the molecular formula C20H17FO3S and a molecular weight of 356.4 g/mol. IUPAC name: 2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methyl]inden-1-ylidene]acetic acid. InChIKey: ZGVNSUASCNFXBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC20H17FO3S
Molecular weight356.4 g/mol
IUPAC name2-[6-fluoro-2-methyl-3-[(4-methylsulfinylphenyl)methyl]inden-1-ylidene]acetic acid
InChIKeyZGVNSUASCNFXBJ-UHFFFAOYSA-N
SMILESCC1=C(C2=C(C1=CC(=O)O)C=C(C=C2)F)CC3=CC=C(C=C3)S(=O)C

Computed by PubChem (NCBI)