Products 191110-90-4

CAS 191110-90-4 is the registry number for 1–Amino–3–((benzyloxy)methyl)cyclobutane–1–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-amino-3-(phenylmethoxymethyl)cyclobutane-1-carboxylic acid (CAS 191110-90-4) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 1-amino-3-(phenylmethoxymethyl)cyclobutane-1-carboxylic acid. InChIKey: CCTNQVJGLNETLT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO3
Molecular weight235.28 g/mol
IUPAC name1-amino-3-(phenylmethoxymethyl)cyclobutane-1-carboxylic acid
InChIKeyCCTNQVJGLNETLT-UHFFFAOYSA-N
SMILESC1C(CC1(C(=O)O)N)COCC2=CC=CC=C2

Computed by PubChem (NCBI)