Products 19156-56-0

CAS 19156-56-0 appears in our catalog under these names: 2,3-Dihydrobenzo(b)thiophene-3-carboxylic acid, 97%, 2,3-Dihydro-1-benzothiophene-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 50mg, 0,5g.

2,3-dihydro-1-benzothiophene-3-carboxylic acid (CAS 19156-56-0) is a chemical compound with the molecular formula C9H8O2S and a molecular weight of 180.23 g/mol. IUPAC name: 2,3-dihydro-1-benzothiophene-3-carboxylic acid. InChIKey: FDHVMZWQPQMDSU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8O2S
Molecular weight180.23 g/mol
IUPAC name2,3-dihydro-1-benzothiophene-3-carboxylic acid
InChIKeyFDHVMZWQPQMDSU-UHFFFAOYSA-N
SMILESC1C(C2=CC=CC=C2S1)C(=O)O

Computed by PubChem (NCBI)