Products 27916-82-1

CAS 27916-82-1 appears in our catalog under these names: 2,3-Dihydro-1-benzothiophene-2-carboxylic acid, 2,3-Dihydrobenzo(b)thiophene-2-carboxylic acid, 95+%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 5g, 10g.

2,3-dihydro-1-benzothiophene-2-carboxylic acid (CAS 27916-82-1) is a chemical compound with the molecular formula C9H8O2S and a molecular weight of 180.23 g/mol. IUPAC name: 2,3-dihydro-1-benzothiophene-2-carboxylic acid. InChIKey: GSCAVDGYZRSZJS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8O2S
Molecular weight180.23 g/mol
IUPAC name2,3-dihydro-1-benzothiophene-2-carboxylic acid
InChIKeyGSCAVDGYZRSZJS-UHFFFAOYSA-N
SMILESC1C(SC2=CC=CC=C21)C(=O)O

Computed by PubChem (NCBI)