CAS 340771-31-5 appears in our catalog under these names: 1-Ethynyl-4-(methylsulfonyl)benzene 95%, 1-Ethynyl-4-(Methylsulfonyl)Benzene, 95%, 95%, 4-(Methylsulfonyl)phenylacetylene, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-ethynyl-4-methylsulfonylbenzene (CAS 340771-31-5) is a chemical compound with the molecular formula C9H8O2S and a molecular weight of 180.23 g/mol. IUPAC name: 1-ethynyl-4-methylsulfonylbenzene. InChIKey: LFIDRFMWWROMOU-UHFFFAOYSA-N.
| Molecular formula | C9H8O2S |
|---|---|
| Molecular weight | 180.23 g/mol |
| IUPAC name | 1-ethynyl-4-methylsulfonylbenzene |
| InChIKey | LFIDRFMWWROMOU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C#C |
Computed by PubChem (NCBI)