CAS 191595-63-8 appears in our catalog under these names: 2–Hydroxy–6–trifluoromethylnicotinic acid, 2-Hydroxy-6-(trifluoromethyl)nicotinic acid, 98%, 98%, 2-Hydroxy-6-(trifluoromethyl)nicotinic acid, 95%, 2-Hydroxy-6-trifluoromethylnicotinic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 50g, 100g.
2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylic acid (CAS 191595-63-8) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylic acid. InChIKey: JPOIZUVDMRHIIT-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxylic acid |
| InChIKey | JPOIZUVDMRHIIT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)