CAS 191608-40-9 appears in our catalog under these names: 7-(Trifluoromethyl)chroman-4-amine hydrochloride, 95%, 7–(Trifluoromethyl)chroman–4–amine hydrochloride, 7-(Trifluoromethyl)chroman-4-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 191608-40-9) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: XHGVNIMNZBUBRZ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | XHGVNIMNZBUBRZ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=CC(=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)