CAS 1341497-24-2 is the registry number for 1-[2-Chloro-4-(2,2,2-trifluoro-ethoxy)-phenyl]-ethylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]ethanamine (CAS 1341497-24-2) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 1-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]ethanamine. InChIKey: CUHNOSMYLGVPAC-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 1-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]ethanamine |
| InChIKey | CUHNOSMYLGVPAC-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)OCC(F)(F)F)Cl)N |
Computed by PubChem (NCBI)