CAS 1236862-38-6 appears in our catalog under these names: 3-(4-(Trifluoromethyl)phenoxy)azetidine hydrochloride, 95%, 3-(4-(Trifluoromethyl)phenoxy)azetidine hydrochloride, 96%, 3-(4-(Trifluoromethyl)phenoxy)azetidine hydrochloride, 96%, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 50mg, 100mg, 10g, 25g, 100g.
3-[4-(trifluoromethyl)phenoxy]azetidine;hydrochloride (CAS 1236862-38-6) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenoxy]azetidine;hydrochloride. InChIKey: ABQHNGFCRJATSS-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenoxy]azetidine;hydrochloride |
| InChIKey | ABQHNGFCRJATSS-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)